ChemNet > CAS > 337508-58-4 1H-benzimidazole-2-carbonyl chloride hydrochloride
337508-58-4 1H-benzimidazole-2-carbonyl chloride hydrochloride
Naam product |
1H-benzimidazole-2-carbonyl chloride hydrochloride |
Synoniemen |
1H-benzimidazole-2-carbonyl chloride |
MF |
C8H5ClN2O |
Molecuulgewicht |
180.5911 |
InChI |
InChI=1/C8H5ClN2O/c9-7(12)8-10-5-3-1-2-4-6(5)11-8/h1-4H,(H,10,11) |
CAS-nummer |
337508-58-4 |
Moleculaire Structuur |
|
Dichtheid |
1.486g/cm3 |
Kookpunt |
379.6°C at 760 mmHg |
Brekingsindex |
1.698 |
Vlampunt |
183.4°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|